C10H11F2NO5S — CID 166267311
5,5-difluoro-1-(furan-2-ylsulfonyl)piperidine-3-carboxylic acid (PubChem CID 166267311) has the molecular formula C10H11F2NO5S and a molecular weight of 295.26 g/mol. Its IUPAC name is 5,5-difluoro-1-(furan-2-ylsulfonyl)piperidine-3-carboxylic acid.
| Compound Name | 5,5-difluoro-1-(furan-2-ylsulfonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166267311 |
| Molecular Formula | C10H11F2NO5S |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5,5-difluoro-1-(furan-2-ylsulfonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(S(=O)(=O)c2ccco2)CC(F)(F)C1 |
| InChI | InChI=1S/C10H11F2NO5S/c11-10(12)4-7(9(14)15)5-13(6-10)19(16,17)8-2-1-3-18-8/h1-3,7H,4-6H2,(H,14,15) |
| InChIKey | VKSHVGYXPGGSEI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |