C16H18N2O3S — CID 166275242
(1S,6R)-6-[(5-methoxy-1,3-benzothiazol-2-yl)methylamino]cyclohex-3-ene-1-carboxylic acid (PubChem CID 166275242) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is (1S,6R)-6-[(5-methoxy-1,3-benzothiazol-2-yl)methylamino]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[(5-methoxy-1,3-benzothiazol-2-yl)methylamino]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 166275242 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (1S,6R)-6-[(5-methoxy-1,3-benzothiazol-2-yl)methylamino]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COc1ccc2sc(CN[C@@H]3CC=CC[C@@H]3C(=O)O)nc2c1 |
| InChI | InChI=1S/C16H18N2O3S/c1-21-10-6-7-14-13(8-10)18-15(22-14)9-17-12-5-3-2-4-11(12)16(19)20/h2-3,6-8,11-12,17H,4-5,9H2,1H3,(H,19,20)/t11-,12+/m0/s1 |
| InChIKey | WWWGUVYBWPYOOE-NWDGAFQWSA-N |
| XLogP | 2.81 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|