C12H15NO5S — CID 166288038
1-(2,5-dimethylfuran-3-yl)sulfonyl-3,6-dihydro-2H-pyridine-3-carboxylic acid (PubChem CID 166288038) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 1-(2,5-dimethylfuran-3-yl)sulfonyl-3,6-dihydro-2H-pyridine-3-carboxylic acid.
| Compound Name | 1-(2,5-dimethylfuran-3-yl)sulfonyl-3,6-dihydro-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 166288038 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-(2,5-dimethylfuran-3-yl)sulfonyl-3,6-dihydro-2H-pyridine-3-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CC=CC(C(=O)O)C2)c(C)o1 |
| InChI | InChI=1S/C12H15NO5S/c1-8-6-11(9(2)18-8)19(16,17)13-5-3-4-10(7-13)12(14)15/h3-4,6,10H,5,7H2,1-2H3,(H,14,15) |
| InChIKey | KPXHYDIUAJNSDQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|