C17H25F3N2O2 — CID 166293070
(3R)-1-[3-[[2-hydroxy-3-[4-(trifluoromethyl)phenyl]propyl]amino]propyl]pyrrolidin-3-ol (PubChem CID 166293070) has the molecular formula C17H25F3N2O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is (3R)-1-[3-[[2-hydroxy-3-[4-(trifluoromethyl)phenyl]propyl]amino]propyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[3-[[2-hydroxy-3-[4-(trifluoromethyl)phenyl]propyl]amino]propyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 166293070 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (3R)-1-[3-[[2-hydroxy-3-[4-(trifluoromethyl)phenyl]propyl]amino]propyl]pyrrolidin-3-ol |
| SMILES | OC(CNCCCN1CC[C@@H](O)C1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H25F3N2O2/c18-17(19,20)14-4-2-13(3-5-14)10-16(24)11-21-7-1-8-22-9-6-15(23)12-22/h2-5,15-16,21,23-24H,1,6-12H2/t15-,16?/m1/s1 |
| InChIKey | MJGSSRWPFWFUNS-AAFJCEBUSA-N |
| XLogP | 1.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|