C17H20N4O2 — CID 166295293
N,N-dimethyl-5-(5-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-8-yl)pyridine-3-carboxamide (PubChem CID 166295293) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N,N-dimethyl-5-(5-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-8-yl)pyridine-3-carboxamide.
| Compound Name | N,N-dimethyl-5-(5-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-8-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166295293 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N,N-dimethyl-5-(5-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-8-yl)pyridine-3-carboxamide |
| SMILES | CC1CCNC(=O)c2cc(-c3cncc(C(=O)N(C)C)c3)cn21 |
| InChI | InChI=1S/C17H20N4O2/c1-11-4-5-19-16(22)15-7-14(10-21(11)15)12-6-13(9-18-8-12)17(23)20(2)3/h6-11H,4-5H2,1-3H3,(H,19,22) |
| InChIKey | CHXVKCLEKMXGEZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |