C11H12N4O3S — CID 166295341
N'-[2-methyl-2-(1,2-thiazol-4-yl)propanoyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 166295341) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is N'-[2-methyl-2-(1,2-thiazol-4-yl)propanoyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | N'-[2-methyl-2-(1,2-thiazol-4-yl)propanoyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 166295341 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N'-[2-methyl-2-(1,2-thiazol-4-yl)propanoyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | CC(C)(C(=O)NNC(=O)c1ccon1)c1cnsc1 |
| InChI | InChI=1S/C11H12N4O3S/c1-11(2,7-5-12-19-6-7)10(17)14-13-9(16)8-3-4-18-15-8/h3-6H,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | HPNZEAZXYUBEFU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|