C14H9ClFN3O4S — CID 166302689
N-(3-chloro-4-fluorophenyl)-2,4-dioxo-1H-quinazoline-6-sulfonamide (PubChem CID 166302689) has the molecular formula C14H9ClFN3O4S and a molecular weight of 369.76 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2,4-dioxo-1H-quinazoline-6-sulfonamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2,4-dioxo-1H-quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 166302689 |
| Molecular Formula | C14H9ClFN3O4S |
| Molecular Weight | 369.76 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2,4-dioxo-1H-quinazoline-6-sulfonamide |
| SMILES | O=c1[nH]c(=O)c2cc(S(=O)(=O)Nc3ccc(F)c(Cl)c3)ccc2[nH]1 |
| InChI | InChI=1S/C14H9ClFN3O4S/c15-10-5-7(1-3-11(10)16)19-24(22,23)8-2-4-12-9(6-8)13(20)18-14(21)17-12/h1-6,19H,(H2,17,18,20,21) |
| InChIKey | DPVIWIDHNMQLQO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |