C12H22N2S2 — CID 166306123
N-(1,3-dithian-5-yl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 166306123) has the molecular formula C12H22N2S2 and a molecular weight of 258.46 g/mol. Its IUPAC name is N-(1,3-dithian-5-yl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | N-(1,3-dithian-5-yl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 166306123 |
| Molecular Formula | C12H22N2S2 |
| Molecular Weight | 258.46 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-(1,3-dithian-5-yl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | CN1CC2CCC(NC3CSCSC3)C2C1 |
| InChI | InChI=1S/C12H22N2S2/c1-14-4-9-2-3-12(11(9)5-14)13-10-6-15-8-16-7-10/h9-13H,2-8H2,1H3 |
| InChIKey | CRIAVYYLDFSRJJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |