C9H13N3O4S — CID 166315155
5-[(5-ethoxy-1,3,4-thiadiazol-2-yl)amino]-5-oxopentanoic acid (PubChem CID 166315155) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is 5-[(5-ethoxy-1,3,4-thiadiazol-2-yl)amino]-5-oxopentanoic acid.
| Compound Name | 5-[(5-ethoxy-1,3,4-thiadiazol-2-yl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166315155 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 5-[(5-ethoxy-1,3,4-thiadiazol-2-yl)amino]-5-oxopentanoic acid |
| SMILES | CCOc1nnc(NC(=O)CCCC(=O)O)s1 |
| InChI | InChI=1S/C9H13N3O4S/c1-2-16-9-12-11-8(17-9)10-6(13)4-3-5-7(14)15/h2-5H2,1H3,(H,14,15)(H,10,11,13) |
| InChIKey | LMZUNWSVWRRUGG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |