About methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate
methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate (PubChem CID 166315873) has the molecular formula C20H22N4O3
and a molecular weight of 366.42 g/mol. Its IUPAC name is methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate |
| PubChem CID | 166315873 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2CN(C(=O)c3ncnc4c3CCC4)CCN2)cc1 |
| InChI | InChI=1S/C20H22N4O3/c1-27-20(26)14-7-5-13(6-8-14)17-11-24(10-9-21-17)19(25)18-15-3-2-4-16(15)22-12-23-18/h5-8,12,17,21H,2-4,9-11H2,1H3 |
| InChIKey | DZHVYBDFGZIYNL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate?
The IUPAC name of methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate (CID 166315873) is methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate.
What is the SMILES notation for methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate?
The canonical SMILES for methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate is COC(=O)c1ccc(C2CN(C(=O)c3ncnc4c3CCC4)CCN2)cc1.
What is the InChIKey of methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate?
The InChIKey is DZHVYBDFGZIYNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O3/c1-27-20(26)14-7-5-13(6-8-14)17-11-24(10-9-21-17)19(25)18-15-3-2-4-16(15)22-12-23-18/h5-8,12,17,21H,2-4,9-11H2,1H3.
What are the key properties of methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate?
methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate has a molecular weight of 366.42 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-carbonyl)piperazin-2-yl]benzoate is sourced from PubChem (CID 166315873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).