C23H23N5O6 — CID 166324631
2-(3,4-dioxo-2,6,7,9-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl)-2-oxo-N-[3-(2-phenoxyethoxymethyl)phenyl]acetamide (PubChem CID 166324631) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is 2-(3,4-dioxo-2,6,7,9-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl)-2-oxo-N-[3-(2-phenoxyethoxymethyl)phenyl]acetamide.
| Compound Name | 2-(3,4-dioxo-2,6,7,9-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl)-2-oxo-N-[3-(2-phenoxyethoxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 166324631 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-(3,4-dioxo-2,6,7,9-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl)-2-oxo-N-[3-(2-phenoxyethoxymethyl)phenyl]acetamide |
| SMILES | O=C(Nc1cccc(COCCOc2ccccc2)c1)C(=O)N1CCn2c(n[nH]c(=O)c2=O)C1 |
| InChI | InChI=1S/C23H23N5O6/c29-20(22(31)27-9-10-28-19(14-27)25-26-21(30)23(28)32)24-17-6-4-5-16(13-17)15-33-11-12-34-18-7-2-1-3-8-18/h1-8,13H,9-12,14-15H2,(H,24,29)(H,26,30) |
| InChIKey | BJRHAGHEOBOGNA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|