C25H25FN4O4 — CID 166326140
6-[(5aS,8aS)-3,5,5a,6,8,8a-hexahydro-2H-furo[3,4-f][1,4]oxazepin-4-yl]-N-[[3-(2-fluorophenoxy)phenyl]methyl]pyrazine-2-carboxamide (PubChem CID 166326140) has the molecular formula C25H25FN4O4 and a molecular weight of 464.50 g/mol. Its IUPAC name is 6-[(5aS,8aS)-3,5,5a,6,8,8a-hexahydro-2H-furo[3,4-f][1,4]oxazepin-4-yl]-N-[[3-(2-fluorophenoxy)phenyl]methyl]pyrazine-2-carboxamide.
| Compound Name | 6-[(5aS,8aS)-3,5,5a,6,8,8a-hexahydro-2H-furo[3,4-f][1,4]oxazepin-4-yl]-N-[[3-(2-fluorophenoxy)phenyl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166326140 |
| Molecular Formula | C25H25FN4O4 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 6-[(5aS,8aS)-3,5,5a,6,8,8a-hexahydro-2H-furo[3,4-f][1,4]oxazepin-4-yl]-N-[[3-(2-fluorophenoxy)phenyl]methyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCc1cccc(Oc2ccccc2F)c1)c1cncc(N2CCO[C@@H]3COC[C@@H]3C2)n1 |
| InChI | InChI=1S/C25H25FN4O4/c26-20-6-1-2-7-22(20)34-19-5-3-4-17(10-19)11-28-25(31)21-12-27-13-24(29-21)30-8-9-33-23-16-32-15-18(23)14-30/h1-7,10,12-13,18,23H,8-9,11,14-16H2,(H,28,31)/t18-,23+/m0/s1 |
| InChIKey | NSHDEYWYNCXOJY-FDDCHVKYSA-N |
| XLogP | 3.19 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |