C16H21Cl2NO2 — CID 166331353
N-(4-cyclopropyl-2-hydroxybutyl)-3-(2,4-dichlorophenyl)propanamide (PubChem CID 166331353) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.25 g/mol. Its IUPAC name is N-(4-cyclopropyl-2-hydroxybutyl)-3-(2,4-dichlorophenyl)propanamide.
| Compound Name | N-(4-cyclopropyl-2-hydroxybutyl)-3-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 166331353 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-(4-cyclopropyl-2-hydroxybutyl)-3-(2,4-dichlorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)NCC(O)CCC1CC1 |
| InChI | InChI=1S/C16H21Cl2NO2/c17-13-6-4-12(15(18)9-13)5-8-16(21)19-10-14(20)7-3-11-1-2-11/h4,6,9,11,14,20H,1-3,5,7-8,10H2,(H,19,21) |
| InChIKey | IEBRANLCZNMPSU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |