C21H19FN8O4 — CID 166351866
3-[1-[2-[2-fluoro-5-(5-methyltetrazol-1-yl)anilino]-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide (PubChem CID 166351866) has the molecular formula C21H19FN8O4 and a molecular weight of 466.43 g/mol. Its IUPAC name is 3-[1-[2-[2-fluoro-5-(5-methyltetrazol-1-yl)anilino]-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide.
| Compound Name | 3-[1-[2-[2-fluoro-5-(5-methyltetrazol-1-yl)anilino]-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 166351866 |
| Molecular Formula | C21H19FN8O4 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 3-[1-[2-[2-fluoro-5-(5-methyltetrazol-1-yl)anilino]-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide |
| SMILES | Cc1nnnn1-c1ccc(F)c(NC(=O)CN2C(=O)NC(C)(c3cccc(C(N)=O)c3)C2=O)c1 |
| InChI | InChI=1S/C21H19FN8O4/c1-11-26-27-28-30(11)14-6-7-15(22)16(9-14)24-17(31)10-29-19(33)21(2,25-20(29)34)13-5-3-4-12(8-13)18(23)32/h3-9H,10H2,1-2H3,(H2,23,32)(H,24,31)(H,25,34) |
| InChIKey | JICPGKCEHVRXFJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 165.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|