C23H13ClN2O3S — CID 166357818
2-[2-[2-(3-chloro-4-hydroxyphenyl)-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione (PubChem CID 166357818) has the molecular formula C23H13ClN2O3S and a molecular weight of 432.89 g/mol. Its IUPAC name is 2-[2-[2-(3-chloro-4-hydroxyphenyl)-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-(3-chloro-4-hydroxyphenyl)-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166357818 |
| Molecular Formula | C23H13ClN2O3S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 2-[2-[2-(3-chloro-4-hydroxyphenyl)-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccccc1-c1csc(-c2ccc(O)c(Cl)c2)n1 |
| InChI | InChI=1S/C23H13ClN2O3S/c24-17-11-13(9-10-20(17)27)21-25-18(12-30-21)16-7-3-4-8-19(16)26-22(28)14-5-1-2-6-15(14)23(26)29/h1-12,27H |
| InChIKey | GCFSMMINZKEBTH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|