C22H21NO4 — CID 166360266
[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl] 3-isoquinolin-5-ylpropanoate (PubChem CID 166360266) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is [(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl] 3-isoquinolin-5-ylpropanoate.
| Compound Name | [(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl] 3-isoquinolin-5-ylpropanoate |
|---|---|
| PubChem CID | 166360266 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl] 3-isoquinolin-5-ylpropanoate |
| SMILES | C[C@@H](Cc1ccc2c(c1)OCO2)OC(=O)CCc1cccc2cnccc12 |
| InChI | InChI=1S/C22H21NO4/c1-15(11-16-5-7-20-21(12-16)26-14-25-20)27-22(24)8-6-17-3-2-4-18-13-23-10-9-19(17)18/h2-5,7,9-10,12-13,15H,6,8,11,14H2,1H3/t15-/m0/s1 |
| InChIKey | VSULLEUTDZOKPD-HNNXBMFYSA-N |
| XLogP | 4.07 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |