C14H18F2N2O4 — CID 166374387
tert-butyl N-[1-(2,3-difluoroanilino)-1-oxopropan-2-yl]oxycarbamate (PubChem CID 166374387) has the molecular formula C14H18F2N2O4 and a molecular weight of 316.30 g/mol. Its IUPAC name is tert-butyl N-[1-(2,3-difluoroanilino)-1-oxopropan-2-yl]oxycarbamate.
| Compound Name | tert-butyl N-[1-(2,3-difluoroanilino)-1-oxopropan-2-yl]oxycarbamate |
|---|---|
| PubChem CID | 166374387 |
| Molecular Formula | C14H18F2N2O4 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | tert-butyl N-[1-(2,3-difluoroanilino)-1-oxopropan-2-yl]oxycarbamate |
| SMILES | CC(ONC(=O)OC(C)(C)C)C(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C14H18F2N2O4/c1-8(22-18-13(20)21-14(2,3)4)12(19)17-10-7-5-6-9(15)11(10)16/h5-8H,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | HZRNYLUXBOQPGS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|