C20H20ClN3O2S — CID 166387170
5-[3-(4-chlorophenyl)sulfanylpropyl]-3-(2-cyclobutyloxy-4-pyridinyl)-1,2,4-oxadiazole (PubChem CID 166387170) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)sulfanylpropyl]-3-(2-cyclobutyloxy-4-pyridinyl)-1,2,4-oxadiazole.
| Compound Name | 5-[3-(4-chlorophenyl)sulfanylpropyl]-3-(2-cyclobutyloxy-4-pyridinyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 166387170 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 5-[3-(4-chlorophenyl)sulfanylpropyl]-3-(2-cyclobutyloxy-4-pyridinyl)-1,2,4-oxadiazole |
| SMILES | Clc1ccc(SCCCc2nc(-c3ccnc(OC4CCC4)c3)no2)cc1 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-15-6-8-17(9-7-15)27-12-2-5-18-23-20(24-26-18)14-10-11-22-19(13-14)25-16-3-1-4-16/h6-11,13,16H,1-5,12H2 |
| InChIKey | NPNJUNVQTKXOPJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|