C16H11Cl2NO2S — CID 16639718
3,6-dichloro-N-phenylmethoxy-1-benzothiophene-2-carboxamide (PubChem CID 16639718) has the molecular formula C16H11Cl2NO2S and a molecular weight of 352.24 g/mol. Its IUPAC name is 3,6-dichloro-N-phenylmethoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-phenylmethoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 16639718 |
| Molecular Formula | C16H11Cl2NO2S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 3,6-dichloro-N-phenylmethoxy-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NOCc1ccccc1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C16H11Cl2NO2S/c17-11-6-7-12-13(8-11)22-15(14(12)18)16(20)19-21-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,19,20) |
| InChIKey | VHAFSNLGBDWPPX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|