C17H15Cl2NO3 — CID 166399623
2-[4-[[(1S)-1-(2,5-dichlorophenyl)ethyl]carbamoyl]phenyl]acetic acid (PubChem CID 166399623) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-[4-[[(1S)-1-(2,5-dichlorophenyl)ethyl]carbamoyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[(1S)-1-(2,5-dichlorophenyl)ethyl]carbamoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 166399623 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-[4-[[(1S)-1-(2,5-dichlorophenyl)ethyl]carbamoyl]phenyl]acetic acid |
| SMILES | C[C@H](NC(=O)c1ccc(CC(=O)O)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H15Cl2NO3/c1-10(14-9-13(18)6-7-15(14)19)20-17(23)12-4-2-11(3-5-12)8-16(21)22/h2-7,9-10H,8H2,1H3,(H,20,23)(H,21,22)/t10-/m0/s1 |
| InChIKey | KKVXGEOAGZCQHY-JTQLQIEISA-N |
| XLogP | 4.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |