C19H18N4O3 — CID 166401022
(2E,4E)-1-[5-(2,1,3-benzoxadiazole-5-carbonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]hexa-2,4-dien-1-one (PubChem CID 166401022) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is (2E,4E)-1-[5-(2,1,3-benzoxadiazole-5-carbonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-[5-(2,1,3-benzoxadiazole-5-carbonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 166401022 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (2E,4E)-1-[5-(2,1,3-benzoxadiazole-5-carbonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1CC2=C(C1)CN(C(=O)c1ccc3nonc3c1)C2 |
| InChI | InChI=1S/C19H18N4O3/c1-2-3-4-5-18(24)22-9-14-11-23(12-15(14)10-22)19(25)13-6-7-16-17(8-13)21-26-20-16/h2-8H,9-12H2,1H3/b3-2+,5-4+ |
| InChIKey | JVTAJCFHMKZQAD-MQQKCMAXSA-N |
| XLogP | 1.95 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|