C7H6N4O2 — CID 2735455
2,1,3-benzoxadiazole-5-carbohydrazide (PubChem CID 2735455) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 2,1,3-benzoxadiazole-5-carbohydrazide.
| Compound Name | 2,1,3-benzoxadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2735455 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2,1,3-benzoxadiazole-5-carbohydrazide |
| SMILES | NNC(=O)c1ccc2nonc2c1 |
| InChI | InChI=1S/C7H6N4O2/c8-9-7(12)4-1-2-5-6(3-4)11-13-10-5/h1-3H,8H2,(H,9,12) |
| InChIKey | IHHRVMUOPJSRTE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|