C17H20N6O4S — CID 166402596
1-(azepan-4-yl)-N-(1,2-benzoxazol-3-ylmethylsulfonyl)triazole-4-carboxamide (PubChem CID 166402596) has the molecular formula C17H20N6O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is 1-(azepan-4-yl)-N-(1,2-benzoxazol-3-ylmethylsulfonyl)triazole-4-carboxamide.
| Compound Name | 1-(azepan-4-yl)-N-(1,2-benzoxazol-3-ylmethylsulfonyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 166402596 |
| Molecular Formula | C17H20N6O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 1-(azepan-4-yl)-N-(1,2-benzoxazol-3-ylmethylsulfonyl)triazole-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)Cc1noc2ccccc12)c1cn(C2CCCNCC2)nn1 |
| InChI | InChI=1S/C17H20N6O4S/c24-17(14-10-23(22-19-14)12-4-3-8-18-9-7-12)21-28(25,26)11-15-13-5-1-2-6-16(13)27-20-15/h1-2,5-6,10,12,18H,3-4,7-9,11H2,(H,21,24) |
| InChIKey | NZMNAXDEQQLEOB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |