C12H12ClF2NO — CID 166408961
2-chloro-N-[1-[(2,4-difluorophenyl)methyl]cyclopropyl]acetamide (PubChem CID 166408961) has the molecular formula C12H12ClF2NO and a molecular weight of 259.68 g/mol. Its IUPAC name is 2-chloro-N-[1-[(2,4-difluorophenyl)methyl]cyclopropyl]acetamide.
| Compound Name | 2-chloro-N-[1-[(2,4-difluorophenyl)methyl]cyclopropyl]acetamide |
|---|---|
| PubChem CID | 166408961 |
| Molecular Formula | C12H12ClF2NO |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-chloro-N-[1-[(2,4-difluorophenyl)methyl]cyclopropyl]acetamide |
| SMILES | O=C(CCl)NC1(Cc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C12H12ClF2NO/c13-7-11(17)16-12(3-4-12)6-8-1-2-9(14)5-10(8)15/h1-2,5H,3-4,6-7H2,(H,16,17) |
| InChIKey | QQFWDQZRSSMIKR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|