C21H19FN2O7S — CID 166419781
5-cyclohexyloxy-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]-4-fluorobenzoic acid (PubChem CID 166419781) has the molecular formula C21H19FN2O7S and a molecular weight of 462.46 g/mol. Its IUPAC name is 5-cyclohexyloxy-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]-4-fluorobenzoic acid.
| Compound Name | 5-cyclohexyloxy-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 166419781 |
| Molecular Formula | C21H19FN2O7S |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 5-cyclohexyloxy-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]-4-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(OC2CCCCC2)c(F)cc1NS(=O)(=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C21H19FN2O7S/c22-16-10-17(15(21(27)28)9-18(16)31-11-4-2-1-3-5-11)24-32(29,30)12-6-7-13-14(8-12)20(26)23-19(13)25/h6-11,24H,1-5H2,(H,27,28)(H,23,25,26) |
| InChIKey | MECJMECTUYMVHD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|