C17H24N2O7S2 — CID 166425184
3-[2-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166425184) has the molecular formula C17H24N2O7S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-[2-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166425184 |
| Molecular Formula | C17H24N2O7S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-[2-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | COc1cc(C(=O)NCC(=O)NCCSSCCC(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C17H24N2O7S2/c1-24-12-8-11(9-13(25-2)16(12)26-3)17(23)19-10-14(20)18-5-7-28-27-6-4-15(21)22/h8-9H,4-7,10H2,1-3H3,(H,18,20)(H,19,23)(H,21,22) |
| InChIKey | XSLAMPKIEBSUIR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|