C24H23N3O6 — CID 166425679
N-(1,3-benzodioxol-4-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)-N-ethyl-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 166425679) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)-N-ethyl-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)-N-ethyl-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 166425679 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)-N-ethyl-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | CCN(Cc1cccc2c1OCO2)C(=O)c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H23N3O6/c1-2-26(11-15-4-3-5-19-21(15)33-13-32-19)23(30)14-6-7-17-16(10-14)12-27(24(17)31)18-8-9-20(28)25-22(18)29/h3-7,10,18H,2,8-9,11-13H2,1H3,(H,25,28,29) |
| InChIKey | UHMPYAWYQGPZKA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|