C24H23N3O6 — CID 166425955
2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]-(2-phenylethyl)amino]acetic acid (PubChem CID 166425955) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]-(2-phenylethyl)amino]acetic acid.
| Compound Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]-(2-phenylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 166425955 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]-(2-phenylethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCc1ccccc1)C(=O)c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H23N3O6/c28-20-9-8-19(22(31)25-20)27-13-17-12-16(6-7-18(17)24(27)33)23(32)26(14-21(29)30)11-10-15-4-2-1-3-5-15/h1-7,12,19H,8-11,13-14H2,(H,29,30)(H,25,28,31) |
| InChIKey | YNMXQFUSHIPHMX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|