C19H15N5O5S — CID 166426826
5-cyano-N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]pyridine-3-sulfonamide (PubChem CID 166426826) has the molecular formula C19H15N5O5S and a molecular weight of 425.43 g/mol. Its IUPAC name is 5-cyano-N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]pyridine-3-sulfonamide.
| Compound Name | 5-cyano-N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 166426826 |
| Molecular Formula | C19H15N5O5S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 5-cyano-N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]pyridine-3-sulfonamide |
| SMILES | N#Cc1cncc(S(=O)(=O)Nc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)c1 |
| InChI | InChI=1S/C19H15N5O5S/c20-7-11-5-14(9-21-8-11)30(28,29)23-13-2-1-12-10-24(19(27)15(12)6-13)16-3-4-17(25)22-18(16)26/h1-2,5-6,8-9,16,23H,3-4,10H2,(H,22,25,26) |
| InChIKey | PSFRFWDGPOGDPK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 149.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|