C28H32N4O6 — CID 166429543
N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-6-[(2-methoxy-1-phenylethyl)amino]hexanamide (PubChem CID 166429543) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-6-[(2-methoxy-1-phenylethyl)amino]hexanamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-6-[(2-methoxy-1-phenylethyl)amino]hexanamide |
|---|---|
| PubChem CID | 166429543 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-6-[(2-methoxy-1-phenylethyl)amino]hexanamide |
| SMILES | COCC(NCCCCCC(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O6/c1-38-17-21(18-9-4-2-5-10-18)29-16-7-3-6-13-23(33)30-20-12-8-11-19-25(20)28(37)32(27(19)36)22-14-15-24(34)31-26(22)35/h2,4-5,8-12,21-22,29H,3,6-7,13-17H2,1H3,(H,30,33)(H,31,34,35) |
| InChIKey | HKHVTQPVSBAZAY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|