C17H19F3N4O — CID 166430355
(3R)-3-amino-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(2,4,5-trifluorophenyl)butanamide (PubChem CID 166430355) has the molecular formula C17H19F3N4O and a molecular weight of 352.36 g/mol. Its IUPAC name is (3R)-3-amino-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(2,4,5-trifluorophenyl)butanamide.
| Compound Name | (3R)-3-amino-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(2,4,5-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 166430355 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (3R)-3-amino-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(2,4,5-trifluorophenyl)butanamide |
| SMILES | C#CCCC1(CCNC(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)N=N1 |
| InChI | InChI=1S/C17H19F3N4O/c1-2-3-4-17(23-24-17)5-6-22-16(25)9-12(21)7-11-8-14(19)15(20)10-13(11)18/h1,8,10,12H,3-7,9,21H2,(H,22,25)/t12-/m1/s1 |
| InChIKey | NTCYILAUXDWLEG-GFCCVEGCSA-N |
| XLogP | 2.45 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|