C24H22N4O5 — CID 166431161
N-[4-[3-(2,4-dioxo-1H-quinazolin-3-yl)propylcarbamoyl]phenyl]-3-methylfuran-2-carboxamide (PubChem CID 166431161) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is N-[4-[3-(2,4-dioxo-1H-quinazolin-3-yl)propylcarbamoyl]phenyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[4-[3-(2,4-dioxo-1H-quinazolin-3-yl)propylcarbamoyl]phenyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 166431161 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[4-[3-(2,4-dioxo-1H-quinazolin-3-yl)propylcarbamoyl]phenyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1ccc(C(=O)NCCCn2c(=O)[nH]c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H22N4O5/c1-15-11-14-33-20(15)22(30)26-17-9-7-16(8-10-17)21(29)25-12-4-13-28-23(31)18-5-2-3-6-19(18)27-24(28)32/h2-3,5-11,14H,4,12-13H2,1H3,(H,25,29)(H,26,30)(H,27,32) |
| InChIKey | GMVOSNKYMDBEFJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 126.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|