C24H20FN3O6 — CID 166435749
[2-[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]-2-oxoethyl] 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate (PubChem CID 166435749) has the molecular formula C24H20FN3O6 and a molecular weight of 465.44 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]-2-oxoethyl] 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]-2-oxoethyl] 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 166435749 |
| Molecular Formula | C24H20FN3O6 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | [2-[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]-2-oxoethyl] 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)C2CC(=O)Nc3cc(F)ccc32)c(C)n1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H20FN3O6/c1-13-8-19(14(2)27(13)16-4-3-5-17(10-16)28(32)33)22(29)12-34-24(31)20-11-23(30)26-21-9-15(25)6-7-18(20)21/h3-10,20H,11-12H2,1-2H3,(H,26,30) |
| InChIKey | XJHRYTOWDVGVDY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|