C21H21FN2O4S — CID 25350909
[2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (7aS)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-7a-carboxylate (PubChem CID 25350909) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (7aS)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-7a-carboxylate.
| Compound Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (7aS)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-7a-carboxylate |
|---|---|
| PubChem CID | 25350909 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (7aS)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-7a-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)[C@@]23CCC(=O)N2CCS3)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C21H21FN2O4S/c1-13-10-17(14(2)24(13)16-5-3-4-15(22)11-16)18(25)12-28-20(27)21-7-6-19(26)23(21)8-9-29-21/h3-5,10-11H,6-9,12H2,1-2H3/t21-/m0/s1 |
| InChIKey | KFDXLMDCNOVOJQ-NRFANRHFSA-N |
| XLogP | 3.02 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|