C15H20O2 — CID 166439938
4,4-dimethyl-7-phenylheptane-2,5-dione (PubChem CID 166439938) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4,4-dimethyl-7-phenylheptane-2,5-dione.
| Compound Name | 4,4-dimethyl-7-phenylheptane-2,5-dione |
|---|---|
| PubChem CID | 166439938 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 4,4-dimethyl-7-phenylheptane-2,5-dione |
| SMILES | CC(=O)CC(C)(C)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C15H20O2/c1-12(16)11-15(2,3)14(17)10-9-13-7-5-4-6-8-13/h4-8H,9-11H2,1-3H3 |
| InChIKey | OUWPMWCWBATAIU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |