C22H36N2OSSi — CID 166441512
O-[(1R,2E,6E)-3,7,11-trimethyl-1-trimethylsilyldodeca-2,6,10-trienyl] imidazole-1-carbothioate (PubChem CID 166441512) has the molecular formula C22H36N2OSSi and a molecular weight of 404.70 g/mol. Its IUPAC name is O-[(1R,2E,6E)-3,7,11-trimethyl-1-trimethylsilyldodeca-2,6,10-trienyl] imidazole-1-carbothioate.
| Compound Name | O-[(1R,2E,6E)-3,7,11-trimethyl-1-trimethylsilyldodeca-2,6,10-trienyl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 166441512 |
| Molecular Formula | C22H36N2OSSi |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | O-[(1R,2E,6E)-3,7,11-trimethyl-1-trimethylsilyldodeca-2,6,10-trienyl] imidazole-1-carbothioate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/[C@H](OC(=S)n1ccnc1)[Si](C)(C)C |
| InChI | InChI=1S/C22H36N2OSSi/c1-18(2)10-8-11-19(3)12-9-13-20(4)16-21(27(5,6)7)25-22(26)24-15-14-23-17-24/h10,12,14-17,21H,8-9,11,13H2,1-7H3/b19-12+,20-16+/t21-/m1/s1 |
| InChIKey | HPILVAFODRQOPM-MAGVHMQSSA-N |
| XLogP | 6.70 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|