C14H16BrF3Si — CID 166443560
[(3S)-3-(3-bromophenyl)-5,5,5-trifluoropent-1-ynyl]-trimethylsilane (PubChem CID 166443560) has the molecular formula C14H16BrF3Si and a molecular weight of 349.27 g/mol. Its IUPAC name is [(3S)-3-(3-bromophenyl)-5,5,5-trifluoropent-1-ynyl]-trimethylsilane.
| Compound Name | [(3S)-3-(3-bromophenyl)-5,5,5-trifluoropent-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 166443560 |
| Molecular Formula | C14H16BrF3Si |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | [(3S)-3-(3-bromophenyl)-5,5,5-trifluoropent-1-ynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#C[C@@H](CC(F)(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H16BrF3Si/c1-19(2,3)8-7-12(10-14(16,17)18)11-5-4-6-13(15)9-11/h4-6,9,12H,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | SSTLVFQYKAWHOP-LBPRGKRZSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|