C27H29NO2S — CID 166444877
ethyl 2-(N-benzylanilino)-2-(4-methylsulfanylphenyl)pent-4-enoate (PubChem CID 166444877) has the molecular formula C27H29NO2S and a molecular weight of 431.60 g/mol. Its IUPAC name is ethyl 2-(N-benzylanilino)-2-(4-methylsulfanylphenyl)pent-4-enoate.
| Compound Name | ethyl 2-(N-benzylanilino)-2-(4-methylsulfanylphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 166444877 |
| Molecular Formula | C27H29NO2S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | ethyl 2-(N-benzylanilino)-2-(4-methylsulfanylphenyl)pent-4-enoate |
| SMILES | C=CCC(C(=O)OCC)(c1ccc(SC)cc1)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO2S/c1-4-20-27(26(29)30-5-2,23-16-18-25(31-3)19-17-23)28(24-14-10-7-11-15-24)21-22-12-8-6-9-13-22/h4,6-19H,1,5,20-21H2,2-3H3 |
| InChIKey | LJRGBHJQDFRBOV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|