C39H27FN2O3 — CID 166446904
(2E)-1'-benzyl-2-(1-benzyl-5-methyl-2-oxoindol-3-ylidene)-5'-fluorospiro[indene-3,3'-indole]-1,2'-dione (PubChem CID 166446904) has the molecular formula C39H27FN2O3 and a molecular weight of 590.65 g/mol. Its IUPAC name is (2E)-1'-benzyl-2-(1-benzyl-5-methyl-2-oxoindol-3-ylidene)-5'-fluorospiro[indene-3,3'-indole]-1,2'-dione.
| Compound Name | (2E)-1'-benzyl-2-(1-benzyl-5-methyl-2-oxoindol-3-ylidene)-5'-fluorospiro[indene-3,3'-indole]-1,2'-dione |
|---|---|
| PubChem CID | 166446904 |
| Molecular Formula | C39H27FN2O3 |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | (2E)-1'-benzyl-2-(1-benzyl-5-methyl-2-oxoindol-3-ylidene)-5'-fluorospiro[indene-3,3'-indole]-1,2'-dione |
| SMILES | Cc1ccc2c(c1)/C(=C1\C(=O)c3ccccc3C13C(=O)N(Cc1ccccc1)c1ccc(F)cc13)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C39H27FN2O3/c1-24-16-18-32-29(20-24)34(37(44)41(32)22-25-10-4-2-5-11-25)35-36(43)28-14-8-9-15-30(28)39(35)31-21-27(40)17-19-33(31)42(38(39)45)23-26-12-6-3-7-13-26/h2-21H,22-23H2,1H3/b35-34- |
| InChIKey | RUJJPPXCYQUMTE-KNWKATPGSA-N |
| XLogP | 7.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|