C49H43N3O4 — CID 73356873
19-[4-[4-(4-acetylphenyl)piperazin-1-yl]butyl]-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione (PubChem CID 73356873) has the molecular formula C49H43N3O4 and a molecular weight of 737.90 g/mol. Its IUPAC name is 19-[4-[4-(4-acetylphenyl)piperazin-1-yl]butyl]-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione.
| Compound Name | 19-[4-[4-(4-acetylphenyl)piperazin-1-yl]butyl]-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione |
|---|---|
| PubChem CID | 73356873 |
| Molecular Formula | C49H43N3O4 |
| Molecular Weight | 737.90 g/mol |
| Exact Mass | 737.33 |
| IUPAC Name | 19-[4-[4-(4-acetylphenyl)piperazin-1-yl]butyl]-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione |
| SMILES | CC(=O)c1ccc(N2CCN(CCCCN3C(=O)C4C(C3=O)C3(c5ccccc5)C(=O)C4(c4ccccc4)c4c3c3ccccc3c3ccccc43)CC2)cc1 |
| InChI | InChI=1S/C49H43N3O4/c1-32(53)33-22-24-36(25-23-33)51-30-28-50(29-31-51)26-12-13-27-52-45(54)43-44(46(52)55)49(35-16-6-3-7-17-35)42-40-21-11-9-19-38(40)37-18-8-10-20-39(37)41(42)48(43,47(49)56)34-14-4-2-5-15-34/h2-11,14-25,43-44H,12-13,26-31H2,1H3 |
| InChIKey | NADOEALZDPMNAQ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.90 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|