C9H7F4NO3 — CID 166448315
1,1,1-trifluoro-2-(3-fluorophenyl)-3-nitropropan-2-ol (PubChem CID 166448315) has the molecular formula C9H7F4NO3 and a molecular weight of 253.15 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(3-fluorophenyl)-3-nitropropan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(3-fluorophenyl)-3-nitropropan-2-ol |
|---|---|
| PubChem CID | 166448315 |
| Molecular Formula | C9H7F4NO3 |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 1,1,1-trifluoro-2-(3-fluorophenyl)-3-nitropropan-2-ol |
| SMILES | O=[N+]([O-])CC(O)(c1cccc(F)c1)C(F)(F)F |
| InChI | InChI=1S/C9H7F4NO3/c10-7-3-1-2-6(4-7)8(15,5-14(16)17)9(11,12)13/h1-4,15H,5H2 |
| InChIKey | XILAOBDBFQBGLL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|