C9H8F4NO2P — CID 175095739
[1,1,1-trifluoro-2-(3-fluorophenyl)-3-nitropropan-2-yl]phosphane (PubChem CID 175095739) has the molecular formula C9H8F4NO2P and a molecular weight of 269.13 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-(3-fluorophenyl)-3-nitropropan-2-yl]phosphane.
| Compound Name | [1,1,1-trifluoro-2-(3-fluorophenyl)-3-nitropropan-2-yl]phosphane |
|---|---|
| PubChem CID | 175095739 |
| Molecular Formula | C9H8F4NO2P |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | [1,1,1-trifluoro-2-(3-fluorophenyl)-3-nitropropan-2-yl]phosphane |
| SMILES | O=[N+]([O-])CC(P)(c1cccc(F)c1)C(F)(F)F |
| InChI | InChI=1S/C9H8F4NO2P/c10-7-3-1-2-6(4-7)8(17,5-14(15)16)9(11,12)13/h1-4H,5,17H2 |
| InChIKey | IPBFPJCTMPOGFH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|