C14H10F4N2O3S — CID 132511345
(3S)-4,4,4-trifluoro-3-(3-fluorophenyl)-3-(nitromethyl)-1-(1,3-thiazol-2-yl)butan-1-one (PubChem CID 132511345) has the molecular formula C14H10F4N2O3S and a molecular weight of 362.30 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-(3-fluorophenyl)-3-(nitromethyl)-1-(1,3-thiazol-2-yl)butan-1-one.
| Compound Name | (3S)-4,4,4-trifluoro-3-(3-fluorophenyl)-3-(nitromethyl)-1-(1,3-thiazol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 132511345 |
| Molecular Formula | C14H10F4N2O3S |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-(3-fluorophenyl)-3-(nitromethyl)-1-(1,3-thiazol-2-yl)butan-1-one |
| SMILES | O=C(C[C@@](C[N+](=O)[O-])(c1cccc(F)c1)C(F)(F)F)c1nccs1 |
| InChI | InChI=1S/C14H10F4N2O3S/c15-10-3-1-2-9(6-10)13(8-20(22)23,14(16,17)18)7-11(21)12-19-4-5-24-12/h1-6H,7-8H2/t13-/m1/s1 |
| InChIKey | DZQAMURESIYDDY-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|