C16H19FN2O3S — CID 175093059
[1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate (PubChem CID 175093059) has the molecular formula C16H19FN2O3S and a molecular weight of 338.40 g/mol. Its IUPAC name is [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate.
| Compound Name | [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 175093059 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate |
| SMILES | CC(O)(OC(=O)N(c1nccs1)C(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C16H19FN2O3S/c1-15(2,3)19(13-18-8-9-23-13)14(20)22-16(4,21)11-6-5-7-12(17)10-11/h5-10,21H,1-4H3 |
| InChIKey | QKKUFCWIEONJKR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|