About [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate
[1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate (PubChem CID 175093059) has the molecular formula C16H19FN2O3S
and a molecular weight of 338.40 g/mol. Its IUPAC name is [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate |
| PubChem CID | 175093059 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate |
| SMILES | CC(O)(OC(=O)N(c1nccs1)C(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C16H19FN2O3S/c1-15(2,3)19(13-18-8-9-23-13)14(20)22-16(4,21)11-6-5-7-12(17)10-11/h5-10,21H,1-4H3 |
| InChIKey | QKKUFCWIEONJKR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate?
The IUPAC name of [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate (CID 175093059) is [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate?
The canonical SMILES for [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate is CC(O)(OC(=O)N(c1nccs1)C(C)(C)C)c1cccc(F)c1.
What is the InChIKey of [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate?
The InChIKey is QKKUFCWIEONJKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19FN2O3S/c1-15(2,3)19(13-18-8-9-23-13)14(20)22-16(4,21)11-6-5-7-12(17)10-11/h5-10,21H,1-4H3.
What are the key properties of [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate?
[1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate has a molecular weight of 338.40 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-fluorophenyl)-1-hydroxyethyl] N-tert-butyl-N-(1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 175093059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).