C27H45NO4Si — CID 166449042
(4S)-4-benzyl-3-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyldecanoyl]-1,3-oxazolidin-2-one (PubChem CID 166449042) has the molecular formula C27H45NO4Si and a molecular weight of 475.75 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyldecanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyldecanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 166449042 |
| Molecular Formula | C27H45NO4Si |
| Molecular Weight | 475.75 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyldecanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@H](CC[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H45NO4Si/c1-8-9-11-16-24(32-33(6,7)27(3,4)5)18-17-21(2)25(29)28-23(20-31-26(28)30)19-22-14-12-10-13-15-22/h10,12-15,21,23-24H,8-9,11,16-20H2,1-7H3/t21-,23-,24+/m0/s1 |
| InChIKey | BKJPSFPTQDEWFR-OEMFJLHTSA-N |
| XLogP | 6.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.75 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|