C21H30BNO4 — CID 166449798
4-(cyclohexylmethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-benzoxazin-3-one (PubChem CID 166449798) has the molecular formula C21H30BNO4 and a molecular weight of 371.29 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-benzoxazin-3-one.
| Compound Name | 4-(cyclohexylmethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 166449798 |
| Molecular Formula | C21H30BNO4 |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 4-(cyclohexylmethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-benzoxazin-3-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)N(CC2CCCCC2)C(=O)CO3)OC1(C)C |
| InChI | InChI=1S/C21H30BNO4/c1-20(2)21(3,4)27-22(26-20)16-10-11-18-17(12-16)23(19(24)14-25-18)13-15-8-6-5-7-9-15/h10-12,15H,5-9,13-14H2,1-4H3 |
| InChIKey | SXKWRFJNJCOBNF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|