C20H19NO7 — CID 166451787
2-(3,4-dihydroxyphenyl)-7-hydroxy-3-(4-hydroxypiperidin-2-yl)oxychromen-4-one (PubChem CID 166451787) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-7-hydroxy-3-(4-hydroxypiperidin-2-yl)oxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-7-hydroxy-3-(4-hydroxypiperidin-2-yl)oxychromen-4-one |
|---|---|
| PubChem CID | 166451787 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-7-hydroxy-3-(4-hydroxypiperidin-2-yl)oxychromen-4-one |
| SMILES | O=c1c(OC2CC(O)CCN2)c(-c2ccc(O)c(O)c2)oc2cc(O)ccc12 |
| InChI | InChI=1S/C20H19NO7/c22-11-2-3-13-16(8-11)27-19(10-1-4-14(24)15(25)7-10)20(18(13)26)28-17-9-12(23)5-6-21-17/h1-4,7-8,12,17,21-25H,5-6,9H2 |
| InChIKey | NXSXEWANTHLKIT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|