C21H24ClNO6 — CID 10645870
3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-3-yl]oxypropyl-trimethylazanium chloride (PubChem CID 10645870) has the molecular formula C21H24ClNO6 and a molecular weight of 421.88 g/mol. Its IUPAC name is 3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-3-yl]oxypropyl-trimethylazanium chloride.
| Compound Name | 3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-3-yl]oxypropyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 10645870 |
| Molecular Formula | C21H24ClNO6 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-3-yl]oxypropyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCCOc1c(-c2ccc(O)c(O)c2)oc2cc(O)ccc2c1=O.[Cl-] |
| InChI | InChI=1S/C21H23NO6.ClH/c1-22(2,3)9-4-10-27-21-19(26)15-7-6-14(23)12-18(15)28-20(21)13-5-8-16(24)17(25)11-13;/h5-8,11-12H,4,9-10H2,1-3H3,(H2-,23,24,25,26);1H |
| InChIKey | XXKOQQYLYQVNLZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|