C20H12O4 — CID 166453632
5-(1,3-benzodioxol-5-yl)-2-hydroxyphenalen-1-one (PubChem CID 166453632) has the molecular formula C20H12O4 and a molecular weight of 316.31 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-2-hydroxyphenalen-1-one.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-2-hydroxyphenalen-1-one |
|---|---|
| PubChem CID | 166453632 |
| Molecular Formula | C20H12O4 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-2-hydroxyphenalen-1-one |
| SMILES | O=C1C(O)=Cc2cc(-c3ccc4c(c3)OCO4)cc3cccc1c23 |
| InChI | InChI=1S/C20H12O4/c21-16-8-14-7-13(11-4-5-17-18(9-11)24-10-23-17)6-12-2-1-3-15(19(12)14)20(16)22/h1-9,21H,10H2 |
| InChIKey | QGEKMPSPWSONRA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |