C24H24N6O3 — CID 166454251
(13S)-13-methyl-10-(3-methyl-1,2,4-oxadiazol-5-yl)-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-2,19-dione (PubChem CID 166454251) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is (13S)-13-methyl-10-(3-methyl-1,2,4-oxadiazol-5-yl)-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-2,19-dione.
| Compound Name | (13S)-13-methyl-10-(3-methyl-1,2,4-oxadiazol-5-yl)-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-2,19-dione |
|---|---|
| PubChem CID | 166454251 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (13S)-13-methyl-10-(3-methyl-1,2,4-oxadiazol-5-yl)-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-2,19-dione |
| SMILES | Cc1noc(-c2cccc3nc4n(c23)[C@@H](C)CCCCNC(=O)c2cccc(c2)C(=O)N4)n1 |
| InChI | InChI=1S/C24H24N6O3/c1-14-7-3-4-12-25-21(31)16-8-5-9-17(13-16)22(32)28-24-27-19-11-6-10-18(20(19)30(14)24)23-26-15(2)29-33-23/h5-6,8-11,13-14H,3-4,7,12H2,1-2H3,(H,25,31)(H,27,28,32)/t14-/m0/s1 |
| InChIKey | YNDSWXZPZUDTKV-AWEZNQCLSA-N |
| XLogP | 4.12 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |